C21H23ClN2O5S — CID 2585598
[2-oxo-2-(propan-2-ylamino)ethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 2585598) has the molecular formula C21H23ClN2O5S and a molecular weight of 450.94 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2585598 |
| Molecular Formula | C21H23ClN2O5S |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C21H23ClN2O5S/c1-4-12-24(16-8-6-5-7-9-16)30(27,28)17-10-11-19(22)18(13-17)21(26)29-14-20(25)23-15(2)3/h4-11,13,15H,1,12,14H2,2-3H3,(H,23,25) |
| InChIKey | FAKBLAWOJCRHIZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|