C21H18ClN3O6S — CID 16591299
[2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 16591299) has the molecular formula C21H18ClN3O6S and a molecular weight of 475.91 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 16591299 |
| Molecular Formula | C21H18ClN3O6S |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2ccon2)c1 |
| InChI | InChI=1S/C21H18ClN3O6S/c1-2-11-25(15-6-4-3-5-7-15)32(28,29)16-8-9-18(22)17(13-16)21(27)30-14-20(26)23-19-10-12-31-24-19/h2-10,12-13H,1,11,14H2,(H,23,24,26) |
| InChIKey | SNKYLJIIFBMKCJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|