C22H21ClN2O6S — CID 27952865
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 27952865) has the molecular formula C22H21ClN2O6S and a molecular weight of 476.94 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 27952865 |
| Molecular Formula | C22H21ClN2O6S |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C#CCNC(=O)COC(=O)c1cc(S(=O)(=O)N(CC=C)c2ccc(OC)cc2)ccc1Cl |
| InChI | InChI=1S/C22H21ClN2O6S/c1-4-12-24-21(26)15-31-22(27)19-14-18(10-11-20(19)23)32(28,29)25(13-5-2)16-6-8-17(30-3)9-7-16/h1,5-11,14H,2,12-13,15H2,3H3,(H,24,26) |
| InChIKey | JSBLRVLUKGKXEE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|