C22H22ClN3O6S — CID 42984668
[2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 42984668) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 42984668 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1OC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NCCC#N)c1 |
| InChI | InChI=1S/C22H22ClN3O6S/c1-3-13-26(19-7-4-5-8-20(19)31-2)33(29,30)16-9-10-18(23)17(14-16)22(28)32-15-21(27)25-12-6-11-24/h3-5,7-10,14H,1,6,12-13,15H2,2H3,(H,25,27) |
| InChIKey | GSWWNUVLKWFRPZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|