C24H31ClN2O5S — CID 46799052
N-(3-butoxypropyl)-2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzamide (PubChem CID 46799052) has the molecular formula C24H31ClN2O5S and a molecular weight of 495.04 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzamide.
| Compound Name | N-(3-butoxypropyl)-2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 46799052 |
| Molecular Formula | C24H31ClN2O5S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-(3-butoxypropyl)-2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1OC)S(=O)(=O)c1ccc(Cl)c(C(=O)NCCCOCCCC)c1 |
| InChI | InChI=1S/C24H31ClN2O5S/c1-4-6-16-32-17-9-14-26-24(28)20-18-19(12-13-21(20)25)33(29,30)27(15-5-2)22-10-7-8-11-23(22)31-3/h5,7-8,10-13,18H,2,4,6,9,14-17H2,1,3H3,(H,26,28) |
| InChIKey | WWKVDNUBNRZCOQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|