C21H20ClN3O4S2 — CID 2673164
2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 2673164) has the molecular formula C21H20ClN3O4S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2673164 |
| Molecular Formula | C21H20ClN3O4S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | C=CCN(c1ccccc1OC)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ncc(C)s2)c1 |
| InChI | InChI=1S/C21H20ClN3O4S2/c1-4-11-25(18-7-5-6-8-19(18)29-3)31(27,28)15-9-10-17(22)16(12-15)20(26)24-21-23-13-14(2)30-21/h4-10,12-13H,1,11H2,2-3H3,(H,23,24,26) |
| InChIKey | CVOUSCBVCMXPAC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|