C23H26ClNO6S — CID 42977798
(3,3-dimethyl-2-oxobutyl) 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 42977798) has the molecular formula C23H26ClNO6S and a molecular weight of 479.98 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 42977798 |
| Molecular Formula | C23H26ClNO6S |
| Molecular Weight | 479.98 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-chloro-5-[(2-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1OC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H26ClNO6S/c1-6-13-25(19-9-7-8-10-20(19)30-5)32(28,29)16-11-12-18(24)17(14-16)22(27)31-15-21(26)23(2,3)4/h6-12,14H,1,13,15H2,2-5H3 |
| InChIKey | RPDAMYHMXYVTPE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|