C16H15ClFNO3S — CID 100542077
N-(2-chlorophenyl)-3-fluoro-4-methoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 100542077) has the molecular formula C16H15ClFNO3S and a molecular weight of 355.82 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-fluoro-4-methoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-3-fluoro-4-methoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100542077 |
| Molecular Formula | C16H15ClFNO3S |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(2-chlorophenyl)-3-fluoro-4-methoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C16H15ClFNO3S/c1-3-10-19(15-7-5-4-6-13(15)17)23(20,21)12-8-9-16(22-2)14(18)11-12/h3-9,11H,1,10H2,2H3 |
| InChIKey | YPQXQPOHRXWUFS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|