C16H15Cl2NO5S — CID 100510771
methyl 2-(2-chloro-N-(3-chloro-4-methoxyphenyl)sulfonylanilino)acetate (PubChem CID 100510771) has the molecular formula C16H15Cl2NO5S and a molecular weight of 404.27 g/mol. Its IUPAC name is methyl 2-(2-chloro-N-(3-chloro-4-methoxyphenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(2-chloro-N-(3-chloro-4-methoxyphenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 100510771 |
| Molecular Formula | C16H15Cl2NO5S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | methyl 2-(2-chloro-N-(3-chloro-4-methoxyphenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccccc1Cl)S(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO5S/c1-23-15-8-7-11(9-13(15)18)25(21,22)19(10-16(20)24-2)14-6-4-3-5-12(14)17/h3-9H,10H2,1-2H3 |
| InChIKey | JZOYIPHFHQKMKX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |