C16H16FNO5S — CID 100541348
methyl 2-(N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate (PubChem CID 100541348) has the molecular formula C16H16FNO5S and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl 2-(N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 100541348 |
| Molecular Formula | C16H16FNO5S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | methyl 2-(N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C16H16FNO5S/c1-22-15-9-8-13(10-14(15)17)24(20,21)18(11-16(19)23-2)12-6-4-3-5-7-12/h3-10H,11H2,1-2H3 |
| InChIKey | UMHAUDPVQUUAMA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |