C15H13BrFNO5S — CID 100542408
2-(4-bromo-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetic acid (PubChem CID 100542408) has the molecular formula C15H13BrFNO5S and a molecular weight of 418.24 g/mol. Its IUPAC name is 2-(4-bromo-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetic acid.
| Compound Name | 2-(4-bromo-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetic acid |
|---|---|
| PubChem CID | 100542408 |
| Molecular Formula | C15H13BrFNO5S |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | 2-(4-bromo-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)O)c2ccc(Br)cc2)cc1F |
| InChI | InChI=1S/C15H13BrFNO5S/c1-23-14-7-6-12(8-13(14)17)24(21,22)18(9-15(19)20)11-4-2-10(16)3-5-11/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | FVMCWSFBIXGQLC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |