C14H11BrNO4S- — CID 7329873
2-[N-(benzenesulfonyl)-4-bromoanilino]acetate (PubChem CID 7329873) has the molecular formula C14H11BrNO4S- and a molecular weight of 369.22 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-bromoanilino]acetate.
| Compound Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]acetate |
|---|---|
| PubChem CID | 7329873 |
| Molecular Formula | C14H11BrNO4S- |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]acetate |
| SMILES | O=C([O-])CN(c1ccc(Br)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12BrNO4S/c15-11-6-8-12(9-7-11)16(10-14(17)18)21(19,20)13-4-2-1-3-5-13/h1-9H,10H2,(H,17,18)/p-1 |
| InChIKey | GVGQYKZSEMZUKZ-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |