C17H16Cl2FNO5S — CID 100543464
ethyl 2-(3,5-dichloro-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate (PubChem CID 100543464) has the molecular formula C17H16Cl2FNO5S and a molecular weight of 436.29 g/mol. Its IUPAC name is ethyl 2-(3,5-dichloro-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate.
| Compound Name | ethyl 2-(3,5-dichloro-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 100543464 |
| Molecular Formula | C17H16Cl2FNO5S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | ethyl 2-(3,5-dichloro-N-(3-fluoro-4-methoxyphenyl)sulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C17H16Cl2FNO5S/c1-3-26-17(22)10-21(13-7-11(18)6-12(19)8-13)27(23,24)14-4-5-16(25-2)15(20)9-14/h4-9H,3,10H2,1-2H3 |
| InChIKey | QUCCIDKGQNBSDK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |