C18H17F4NO5S — CID 100543118
ethyl 2-[N-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate (PubChem CID 100543118) has the molecular formula C18H17F4NO5S and a molecular weight of 435.40 g/mol. Its IUPAC name is ethyl 2-[N-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate.
| Compound Name | ethyl 2-[N-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 100543118 |
| Molecular Formula | C18H17F4NO5S |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | ethyl 2-[N-(3-fluoro-4-methoxyphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetate |
| SMILES | CCOC(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C18H17F4NO5S/c1-3-28-17(24)11-23(13-6-4-5-12(9-13)18(20,21)22)29(25,26)14-7-8-16(27-2)15(19)10-14/h4-10H,3,11H2,1-2H3 |
| InChIKey | HRQPKLDMRQAQNT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |