C17H15F4NO4S — CID 52689632
ethyl 2-(4-fluoro-N-[3-(trifluoromethyl)phenyl]sulfonylanilino)acetate (PubChem CID 52689632) has the molecular formula C17H15F4NO4S and a molecular weight of 405.37 g/mol. Its IUPAC name is ethyl 2-(4-fluoro-N-[3-(trifluoromethyl)phenyl]sulfonylanilino)acetate.
| Compound Name | ethyl 2-(4-fluoro-N-[3-(trifluoromethyl)phenyl]sulfonylanilino)acetate |
|---|---|
| PubChem CID | 52689632 |
| Molecular Formula | C17H15F4NO4S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | ethyl 2-(4-fluoro-N-[3-(trifluoromethyl)phenyl]sulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F4NO4S/c1-2-26-16(23)11-22(14-8-6-13(18)7-9-14)27(24,25)15-5-3-4-12(10-15)17(19,20)21/h3-10H,2,11H2,1H3 |
| InChIKey | GKQRZJCWCKGMED-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |