C15H10ClF4NO3S — CID 50893250
2-[N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl chloride (PubChem CID 50893250) has the molecular formula C15H10ClF4NO3S and a molecular weight of 395.76 g/mol. Its IUPAC name is 2-[N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl chloride.
| Compound Name | 2-[N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl chloride |
|---|---|
| PubChem CID | 50893250 |
| Molecular Formula | C15H10ClF4NO3S |
| Molecular Weight | 395.76 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 2-[N-(4-fluorophenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl chloride |
| SMILES | O=C(Cl)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10ClF4NO3S/c16-14(22)9-21(12-3-1-2-10(8-12)15(18,19)20)25(23,24)13-6-4-11(17)5-7-13/h1-8H,9H2 |
| InChIKey | DZZXSGFRMLUIGU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|