C19H14F3NO4S — CID 100531866
2-[N-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)anilino]acetic acid (PubChem CID 100531866) has the molecular formula C19H14F3NO4S and a molecular weight of 409.39 g/mol. Its IUPAC name is 2-[N-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)anilino]acetic acid.
| Compound Name | 2-[N-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 100531866 |
| Molecular Formula | C19H14F3NO4S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 2-[N-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)anilino]acetic acid |
| SMILES | O=C(O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H14F3NO4S/c20-19(21,22)15-6-3-7-16(11-15)23(12-18(24)25)28(26,27)17-9-8-13-4-1-2-5-14(13)10-17/h1-11H,12H2,(H,24,25) |
| InChIKey | BIUWHBSXPZOQKJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |