C18H17NO3S — CID 38869062
N-(2-hydroxyethyl)-N-phenylnaphthalene-2-sulfonamide (PubChem CID 38869062) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-phenylnaphthalene-2-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-N-phenylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 38869062 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(2-hydroxyethyl)-N-phenylnaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N(CCO)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3S/c20-13-12-19(17-8-2-1-3-9-17)23(21,22)18-11-10-15-6-4-5-7-16(15)14-18/h1-11,14,20H,12-13H2 |
| InChIKey | AGABUXAPPDRFAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |