C16H13F3N2O6S — CID 50893225
3-[N-(3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid (PubChem CID 50893225) has the molecular formula C16H13F3N2O6S and a molecular weight of 418.35 g/mol. Its IUPAC name is 3-[N-(3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | 3-[N-(3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 50893225 |
| Molecular Formula | C16H13F3N2O6S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 3-[N-(3-nitrophenyl)sulfonyl-3-(trifluoromethyl)anilino]propanoic acid |
| SMILES | O=C(O)CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13F3N2O6S/c17-16(18,19)11-3-1-4-12(9-11)20(8-7-15(22)23)28(26,27)14-6-2-5-13(10-14)21(24)25/h1-6,9-10H,7-8H2,(H,22,23) |
| InChIKey | HXPVCYIEWKOZKD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|