C21H16F3N3O5S — CID 3109583
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3109583) has the molecular formula C21H16F3N3O5S and a molecular weight of 479.44 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3109583 |
| Molecular Formula | C21H16F3N3O5S |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F3N3O5S/c22-21(23,24)15-5-4-6-16(13-15)25-20(28)14-26(17-9-11-18(12-10-17)27(29)30)33(31,32)19-7-2-1-3-8-19/h1-13H,14H2,(H,25,28) |
| InChIKey | QXVCJGFWEFGSJI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|