C16H11F6NO4S — CID 1486690
2-(N-[3,5-bis(trifluoromethyl)phenyl]sulfonylanilino)acetic acid (PubChem CID 1486690) has the molecular formula C16H11F6NO4S and a molecular weight of 427.32 g/mol. Its IUPAC name is 2-(N-[3,5-bis(trifluoromethyl)phenyl]sulfonylanilino)acetic acid.
| Compound Name | 2-(N-[3,5-bis(trifluoromethyl)phenyl]sulfonylanilino)acetic acid |
|---|---|
| PubChem CID | 1486690 |
| Molecular Formula | C16H11F6NO4S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 2-(N-[3,5-bis(trifluoromethyl)phenyl]sulfonylanilino)acetic acid |
| SMILES | O=C(O)CN(c1ccccc1)S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F6NO4S/c17-15(18,19)10-6-11(16(20,21)22)8-13(7-10)28(26,27)23(9-14(24)25)12-4-2-1-3-5-12/h1-8H,9H2,(H,24,25) |
| InChIKey | DZVNTEUVHMSTAW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |