C14H8F13NO4S — CID 18362326
2-[N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid (PubChem CID 18362326) has the molecular formula C14H8F13NO4S and a molecular weight of 533.26 g/mol. Its IUPAC name is 2-[N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid.
| Compound Name | 2-[N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid |
|---|---|
| PubChem CID | 18362326 |
| Molecular Formula | C14H8F13NO4S |
| Molecular Weight | 533.26 g/mol |
| Exact Mass | 533.00 |
| IUPAC Name | 2-[N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid |
| SMILES | O=C(O)CN(c1ccccc1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8F13NO4S/c15-9(16,11(19,20)13(23,24)25)10(17,18)12(21,22)14(26,27)33(31,32)28(6-8(29)30)7-4-2-1-3-5-7/h1-5H,6H2,(H,29,30) |
| InChIKey | JOHLIYPJXLOREY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|