C14H3F18NO4S — CID 18362325
2-[2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid (PubChem CID 18362325) has the molecular formula C14H3F18NO4S and a molecular weight of 623.21 g/mol. Its IUPAC name is 2-[2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid.
| Compound Name | 2-[2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid |
|---|---|
| PubChem CID | 18362325 |
| Molecular Formula | C14H3F18NO4S |
| Molecular Weight | 623.21 g/mol |
| Exact Mass | 622.95 |
| IUPAC Name | 2-[2,3,4,5,6-pentafluoro-N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)anilino]acetic acid |
| SMILES | O=C(O)CN(c1c(F)c(F)c(F)c(F)c1F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H3F18NO4S/c15-3-4(16)6(18)8(7(19)5(3)17)33(1-2(34)35)38(36,37)14(31,32)12(26,27)10(22,23)9(20,21)11(24,25)13(28,29)30/h1H2,(H,34,35) |
| InChIKey | QNFHKISBPPNUGT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|