C21H21F23N2O7S2 — CID 165364585
3-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecylsulfonyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 165364585) has the molecular formula C21H21F23N2O7S2 and a molecular weight of 914.49 g/mol. Its IUPAC name is 3-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecylsulfonyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecylsulfonyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 165364585 |
| Molecular Formula | C21H21F23N2O7S2 |
| Molecular Weight | 914.49 g/mol |
| Exact Mass | 914.04 |
| IUPAC Name | 3-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecylsulfonyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | C[N+](C)(CCCN(CC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C21H21F23N2O7S2/c1-46(2,7-4-8-54(49,50)51)6-3-5-45(9-10(47)48)55(52,53)21(43,44)19(38,39)17(34,35)15(30,31)13(26,27)11(22,23)12(24,25)14(28,29)16(32,33)18(36,37)20(40,41)42/h3-9H2,1-2H3,(H-,47,48,49,50,51) |
| InChIKey | DIFRZIYIDKQUCM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|