C14H20F9N2O6S+ — CID 138394452
3-[2-carboxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-(carboxymethyl)-dimethylazanium (PubChem CID 138394452) has the molecular formula C14H20F9N2O6S+ and a molecular weight of 515.37 g/mol. Its IUPAC name is 3-[2-carboxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-(carboxymethyl)-dimethylazanium.
| Compound Name | 3-[2-carboxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-(carboxymethyl)-dimethylazanium |
|---|---|
| PubChem CID | 138394452 |
| Molecular Formula | C14H20F9N2O6S+ |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 3-[2-carboxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-(carboxymethyl)-dimethylazanium |
| SMILES | C[N+](C)(CCCN(CCC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C14H19F9N2O6S/c1-25(2,8-10(28)29)7-3-5-24(6-4-9(26)27)32(30,31)14(22,23)12(17,18)11(15,16)13(19,20)21/h3-8H2,1-2H3,(H-,26,27,28,29)/p+1 |
| InChIKey | UHZQIGSIOSKJND-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|