C17H19F15N2O6S — CID 165364649
2-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl-dimethylazaniumyl]acetate (PubChem CID 165364649) has the molecular formula C17H19F15N2O6S and a molecular weight of 664.38 g/mol. Its IUPAC name is 2-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl-dimethylazaniumyl]acetate.
| Compound Name | 2-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl-dimethylazaniumyl]acetate |
|---|---|
| PubChem CID | 165364649 |
| Molecular Formula | C17H19F15N2O6S |
| Molecular Weight | 664.38 g/mol |
| Exact Mass | 664.07 |
| IUPAC Name | 2-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl-dimethylazaniumyl]acetate |
| SMILES | C[N+](C)(CCCN(CCC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)[O-] |
| InChI | InChI=1S/C17H19F15N2O6S/c1-34(2,8-10(37)38)7-3-5-33(6-4-9(35)36)41(39,40)17(31,32)15(26,27)13(22,23)11(18,19)12(20,21)14(24,25)16(28,29)30/h3-8H2,1-2H3,(H-,35,36,37,38) |
| InChIKey | BQABKKQUURXTIL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|