C15H23F11N2O6S2 — CID 165364448
3-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propane-1-sulfonate (PubChem CID 165364448) has the molecular formula C15H23F11N2O6S2 and a molecular weight of 600.47 g/mol. Its IUPAC name is 3-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propane-1-sulfonate.
| Compound Name | 3-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 165364448 |
| Molecular Formula | C15H23F11N2O6S2 |
| Molecular Weight | 600.47 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | 3-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]propane-1-sulfonate |
| SMILES | C[N+](C)(CCO)CCCN(CCCS(=O)(=O)[O-])S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H23F11N2O6S2/c1-28(2,8-9-29)7-3-5-27(6-4-10-35(30,31)32)36(33,34)15(25,26)13(20,21)11(16,17)12(18,19)14(22,23)24/h29H,3-10H2,1-2H3 |
| InChIKey | QCCXYHHEWZOHKF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|