C13H23F7N2O6S2 — CID 165364447
3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl]amino]propane-1-sulfonate (PubChem CID 165364447) has the molecular formula C13H23F7N2O6S2 and a molecular weight of 500.46 g/mol. Its IUPAC name is 3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl]amino]propane-1-sulfonate.
| Compound Name | 3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl]amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 165364447 |
| Molecular Formula | C13H23F7N2O6S2 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 3-[1,1,2,2,3,3,3-heptafluoropropylsulfonyl-[3-[2-hydroxyethyl(dimethyl)azaniumyl]propyl]amino]propane-1-sulfonate |
| SMILES | C[N+](C)(CCO)CCCN(CCCS(=O)(=O)[O-])S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H23F7N2O6S2/c1-22(2,8-9-23)7-3-5-21(6-4-10-29(24,25)26)30(27,28)13(19,20)11(14,15)12(16,17)18/h23H,3-10H2,1-2H3 |
| InChIKey | TXCJDGOAAYKATG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|