C12H24F5N2O7S2+ — CID 163324432
2-hydroxyethyl-[3-[(2-hydroxy-3-sulfopropyl)-(1,1,2,2,2-pentafluoroethylsulfonyl)amino]propyl]-dimethylazanium (PubChem CID 163324432) has the molecular formula C12H24F5N2O7S2+ and a molecular weight of 467.46 g/mol. Its IUPAC name is 2-hydroxyethyl-[3-[(2-hydroxy-3-sulfopropyl)-(1,1,2,2,2-pentafluoroethylsulfonyl)amino]propyl]-dimethylazanium.
| Compound Name | 2-hydroxyethyl-[3-[(2-hydroxy-3-sulfopropyl)-(1,1,2,2,2-pentafluoroethylsulfonyl)amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 163324432 |
| Molecular Formula | C12H24F5N2O7S2+ |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 2-hydroxyethyl-[3-[(2-hydroxy-3-sulfopropyl)-(1,1,2,2,2-pentafluoroethylsulfonyl)amino]propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCO)CCCN(CC(O)CS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H23F5N2O7S2/c1-19(2,6-7-20)5-3-4-18(8-10(21)9-27(22,23)24)28(25,26)12(16,17)11(13,14)15/h10,20-21H,3-9H2,1-2H3/p+1 |
| InChIKey | KGEFASUYBIEADJ-UHFFFAOYSA-O |
| XLogP | -0.52 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|