C9H15F9N2O6S2 — CID 170842522
azane;3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid (PubChem CID 170842522) has the molecular formula C9H15F9N2O6S2 and a molecular weight of 482.34 g/mol. Its IUPAC name is azane;3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid.
| Compound Name | azane;3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 170842522 |
| Molecular Formula | C9H15F9N2O6S2 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | azane;3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-hydroxypropane-1-sulfonic acid |
| SMILES | CCN(CC(O)CS(=O)(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.N |
| InChI | InChI=1S/C9H12F9NO6S2.H3N/c1-2-19(3-5(20)4-26(21,22)23)27(24,25)9(17,18)7(12,13)6(10,11)8(14,15)16;/h5,20H,2-4H2,1H3,(H,21,22,23);1H3 |
| InChIKey | COOSUDXRANCQCF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|