C10H14F9NO4S — CID 130342982
1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxypropyl)-N-(3-hydroxypropyl)butane-1-sulfonamide (PubChem CID 130342982) has the molecular formula C10H14F9NO4S and a molecular weight of 415.27 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxypropyl)-N-(3-hydroxypropyl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxypropyl)-N-(3-hydroxypropyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 130342982 |
| Molecular Formula | C10H14F9NO4S |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxypropyl)-N-(3-hydroxypropyl)butane-1-sulfonamide |
| SMILES | CC(O)CN(CCCO)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F9NO4S/c1-6(22)5-20(3-2-4-21)25(23,24)10(18,19)8(13,14)7(11,12)9(15,16)17/h6,21-22H,2-5H2,1H3 |
| InChIKey | DQTZAMZLTMUYNM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|