C9H15F9N2O7S2 — CID 138396267
azanium 2-hydroxy-3-[2-hydroxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propane-1-sulfonate (PubChem CID 138396267) has the molecular formula C9H15F9N2O7S2 and a molecular weight of 498.34 g/mol. Its IUPAC name is azanium 2-hydroxy-3-[2-hydroxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propane-1-sulfonate.
| Compound Name | azanium 2-hydroxy-3-[2-hydroxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 138396267 |
| Molecular Formula | C9H15F9N2O7S2 |
| Molecular Weight | 498.34 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | azanium 2-hydroxy-3-[2-hydroxyethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(O)CN(CCO)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C9H12F9NO7S2.H3N/c10-6(11,8(14,15)16)7(12,13)9(17,18)28(25,26)19(1-2-20)3-5(21)4-27(22,23)24;/h5,20-21H,1-4H2,(H,22,23,24);1H3 |
| InChIKey | XEFXAYIWZZHNIR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|