C8H10F9NO4S — CID 3022204
1,1,2,3,3,3-hexafluoro-N,N-bis(2-hydroxyethyl)-2-(trifluoromethyl)propane-1-sulfonamide (PubChem CID 3022204) has the molecular formula C8H10F9NO4S and a molecular weight of 387.22 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoro-N,N-bis(2-hydroxyethyl)-2-(trifluoromethyl)propane-1-sulfonamide.
| Compound Name | 1,1,2,3,3,3-hexafluoro-N,N-bis(2-hydroxyethyl)-2-(trifluoromethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 3022204 |
| Molecular Formula | C8H10F9NO4S |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoro-N,N-bis(2-hydroxyethyl)-2-(trifluoromethyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(N(CCO)CCO)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F9NO4S/c9-5(6(10,11)12,7(13,14)15)8(16,17)23(21,22)18(1-3-19)2-4-20/h19-20H,1-4H2 |
| InChIKey | QSEWDLHUEPHPCY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |