C9H10F9NO4S — CID 163324775
1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxyethyl)-N-(3-oxopropyl)butane-1-sulfonamide (PubChem CID 163324775) has the molecular formula C9H10F9NO4S and a molecular weight of 399.23 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxyethyl)-N-(3-oxopropyl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxyethyl)-N-(3-oxopropyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 163324775 |
| Molecular Formula | C9H10F9NO4S |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxyethyl)-N-(3-oxopropyl)butane-1-sulfonamide |
| SMILES | O=CCCN(CCO)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9NO4S/c10-6(11,8(14,15)16)7(12,13)9(17,18)24(22,23)19(3-5-21)2-1-4-20/h4,21H,1-3,5H2 |
| InChIKey | WJSLZBLBLVVDJF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|