C20H28F18N4O6S2 — CID 165364433
3-[2-[3-[dimethyl(oxido)azaniumyl]propyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N,N-dimethylpropan-1-amine oxide (PubChem CID 165364433) has the molecular formula C20H28F18N4O6S2 and a molecular weight of 826.56 g/mol. Its IUPAC name is 3-[2-[3-[dimethyl(oxido)azaniumyl]propyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N,N-dimethylpropan-1-amine oxide.
| Compound Name | 3-[2-[3-[dimethyl(oxido)azaniumyl]propyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N,N-dimethylpropan-1-amine oxide |
|---|---|
| PubChem CID | 165364433 |
| Molecular Formula | C20H28F18N4O6S2 |
| Molecular Weight | 826.56 g/mol |
| Exact Mass | 826.12 |
| IUPAC Name | 3-[2-[3-[dimethyl(oxido)azaniumyl]propyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N,N-dimethylpropan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCN(CCN(CCC[N+](C)(C)[O-])S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H28F18N4O6S2/c1-41(2,43)11-5-7-39(49(45,46)19(35,36)15(25,26)13(21,22)17(29,30)31)9-10-40(8-6-12-42(3,4)44)50(47,48)20(37,38)16(27,28)14(23,24)18(32,33)34/h5-12H2,1-4H3 |
| InChIKey | YNZBLBBCFTVAEH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|