C14H25F9N2O6S2 — CID 165360019
3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-trimethylazanium;ethyl sulfate (PubChem CID 165360019) has the molecular formula C14H25F9N2O6S2 and a molecular weight of 552.48 g/mol. Its IUPAC name is 3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-trimethylazanium;ethyl sulfate.
| Compound Name | 3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-trimethylazanium;ethyl sulfate |
|---|---|
| PubChem CID | 165360019 |
| Molecular Formula | C14H25F9N2O6S2 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 3-[ethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl-trimethylazanium;ethyl sulfate |
| SMILES | CCN(CCC[N+](C)(C)C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H20F9N2O2S.C2H6O4S/c1-5-22(7-6-8-23(2,3)4)26(24,25)12(20,21)10(15,16)9(13,14)11(17,18)19;1-2-6-7(3,4)5/h5-8H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | ODLUOWTUDRELMG-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|