C16H18F15N2O6S+ — CID 163324272
carboxymethyl-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]-dimethylazanium (PubChem CID 163324272) has the molecular formula C16H18F15N2O6S+ and a molecular weight of 651.36 g/mol. Its IUPAC name is carboxymethyl-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]-dimethylazanium.
| Compound Name | carboxymethyl-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 163324272 |
| Molecular Formula | C16H18F15N2O6S+ |
| Molecular Weight | 651.36 g/mol |
| Exact Mass | 651.06 |
| IUPAC Name | carboxymethyl-[3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCN(CC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C16H17F15N2O6S/c1-33(2,7-9(36)37)5-3-4-32(6-8(34)35)40(38,39)16(30,31)14(25,26)12(21,22)10(17,18)11(19,20)13(23,24)15(27,28)29/h3-7H2,1-2H3,(H-,34,35,36,37)/p+1 |
| InChIKey | BVVHCHQCRULQLR-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|