C13H15F13NO2+ — CID 163324330
carboxymethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium (PubChem CID 163324330) has the molecular formula C13H15F13NO2+ and a molecular weight of 464.24 g/mol. Its IUPAC name is carboxymethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium.
| Compound Name | carboxymethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium |
|---|---|
| PubChem CID | 163324330 |
| Molecular Formula | C13H15F13NO2+ |
| Molecular Weight | 464.24 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | carboxymethyl-dimethyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)azanium |
| SMILES | C[N+](C)(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C13H14F13NO2/c1-27(2,6-7(28)29)5-3-4-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h3-6H2,1-2H3/p+1 |
| InChIKey | ABVFHPDFMSSHBA-UHFFFAOYSA-O |
| XLogP | 4.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|