C14H17F13NO2+ — CID 139596056
carboxymethyl-dimethyl-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)azanium (PubChem CID 139596056) has the molecular formula C14H17F13NO2+ and a molecular weight of 478.27 g/mol. Its IUPAC name is carboxymethyl-dimethyl-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)azanium.
| Compound Name | carboxymethyl-dimethyl-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)azanium |
|---|---|
| PubChem CID | 139596056 |
| Molecular Formula | C14H17F13NO2+ |
| Molecular Weight | 478.27 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | carboxymethyl-dimethyl-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)azanium |
| SMILES | C[N+](C)(CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C14H16F13NO2/c1-28(2,7-8(29)30)6-4-3-5-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h3-7H2,1-2H3/p+1 |
| InChIKey | MJLPBBJRGAKZKE-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|