C12H16F11N2O4S+ — CID 139597193
carboxymethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium (PubChem CID 139597193) has the molecular formula C12H16F11N2O4S+ and a molecular weight of 493.32 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
|---|---|
| PubChem CID | 139597193 |
| Molecular Formula | C12H16F11N2O4S+ |
| Molecular Weight | 493.32 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | carboxymethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C12H15F11N2O4S/c1-25(2,6-7(26)27)5-3-4-24-30(28,29)12(22,23)10(17,18)8(13,14)9(15,16)11(19,20)21/h24H,3-6H2,1-2H3/p+1 |
| InChIKey | SZVCFALUFWYFMZ-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|