C13H18F11N2O4S+ — CID 139596417
2-carboxyethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium (PubChem CID 139596417) has the molecular formula C13H18F11N2O4S+ and a molecular weight of 507.34 g/mol. Its IUPAC name is 2-carboxyethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium.
| Compound Name | 2-carboxyethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
|---|---|
| PubChem CID | 139596417 |
| Molecular Formula | C13H18F11N2O4S+ |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-carboxyethyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(=O)O |
| InChI | InChI=1S/C13H17F11N2O4S/c1-26(2,7-4-8(27)28)6-3-5-25-31(29,30)13(23,24)11(18,19)9(14,15)10(16,17)12(20,21)22/h25H,3-7H2,1-2H3/p+1 |
| InChIKey | OJVQPNOEIBXLJJ-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|