C16H18F17N2O4S+ — CID 58963623
carboxymethyl-diethyl-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]azanium (PubChem CID 58963623) has the molecular formula C16H18F17N2O4S+ and a molecular weight of 657.36 g/mol. Its IUPAC name is carboxymethyl-diethyl-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]azanium.
| Compound Name | carboxymethyl-diethyl-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]azanium |
|---|---|
| PubChem CID | 58963623 |
| Molecular Formula | C16H18F17N2O4S+ |
| Molecular Weight | 657.36 g/mol |
| Exact Mass | 657.07 |
| IUPAC Name | carboxymethyl-diethyl-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)ethyl]azanium |
| SMILES | CC[N+](CC)(CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C16H17F17N2O4S/c1-3-35(4-2,7-8(36)37)6-5-34-40(38,39)16(32,33)14(27,28)12(23,24)10(19,20)9(17,18)11(21,22)13(25,26)15(29,30)31/h34H,3-7H2,1-2H3/p+1 |
| InChIKey | KNTZDGQNQQAFHM-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|