C14H17F13N2O4S — CID 15936208
3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azaniumyl]propanoate (PubChem CID 15936208) has the molecular formula C14H17F13N2O4S and a molecular weight of 556.34 g/mol. Its IUPAC name is 3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azaniumyl]propanoate.
| Compound Name | 3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 15936208 |
| Molecular Formula | C14H17F13N2O4S |
| Molecular Weight | 556.34 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | 3-[dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azaniumyl]propanoate |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(=O)[O-] |
| InChI | InChI=1S/C14H17F13N2O4S/c1-29(2,7-4-8(30)31)6-3-5-28-34(32,33)14(26,27)12(21,22)10(17,18)9(15,16)11(19,20)13(23,24)25/h28H,3-7H2,1-2H3 |
| InChIKey | YMWSFPVNOMOHTB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|