C14H22F11N2O6S2+ — CID 139595259
2-hydroxyethyl-methyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium (PubChem CID 139595259) has the molecular formula C14H22F11N2O6S2+ and a molecular weight of 587.45 g/mol. Its IUPAC name is 2-hydroxyethyl-methyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium.
| Compound Name | 2-hydroxyethyl-methyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
|---|---|
| PubChem CID | 139595259 |
| Molecular Formula | C14H22F11N2O6S2+ |
| Molecular Weight | 587.45 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | 2-hydroxyethyl-methyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
| SMILES | C[N+](CCO)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C14H21F11N2O6S2/c1-27(7-8-28,6-3-9-34(29,30)31)5-2-4-26-35(32,33)14(24,25)12(19,20)10(15,16)11(17,18)13(21,22)23/h26,28H,2-9H2,1H3/p+1 |
| InChIKey | HLWUIPDYTTVITM-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|