C10H10F13NO3S — CID 141055320
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(4-hydroxybutyl)hexane-1-sulfonamide (PubChem CID 141055320) has the molecular formula C10H10F13NO3S and a molecular weight of 471.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(4-hydroxybutyl)hexane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(4-hydroxybutyl)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 141055320 |
| Molecular Formula | C10H10F13NO3S |
| Molecular Weight | 471.24 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(4-hydroxybutyl)hexane-1-sulfonamide |
| SMILES | O=S(=O)(NCCCCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F13NO3S/c11-5(12,7(15,16)9(19,20)21)6(13,14)8(17,18)10(22,23)28(26,27)24-3-1-2-4-25/h24-25H,1-4H2 |
| InChIKey | VDXJTOKBBFENIA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|