C13H10F22O8S2 — CID 87128295
propane-1,3-diol;bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonic acid) (PubChem CID 87128295) has the molecular formula C13H10F22O8S2 and a molecular weight of 776.30 g/mol. Its IUPAC name is propane-1,3-diol;bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonic acid).
| Compound Name | propane-1,3-diol;bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonic acid) |
|---|---|
| PubChem CID | 87128295 |
| Molecular Formula | C13H10F22O8S2 |
| Molecular Weight | 776.30 g/mol |
| Exact Mass | 775.95 |
| IUPAC Name | propane-1,3-diol;bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonic acid) |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OCCCO |
| InChI | InChI=1S/2C5HF11O3S.C3H8O2/c2*6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)20(17,18)19;4-2-1-3-5/h2*(H,17,18,19);4-5H,1-3H2 |
| InChIKey | PESMNZUEHPKBIE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|