C7HF15NaO3S — CID 87558139
sodium perfluoroheptanesulfonate (PubChem CID 87558139) has the molecular formula C7HF15NaO3S and a molecular weight of 473.11 g/mol.
| Compound Name | sodium perfluoroheptanesulfonate |
|---|---|
| PubChem CID | 87558139 |
| Molecular Formula | C7HF15NaO3S |
| Molecular Weight | 473.11 g/mol |
| Exact Mass | 472.93 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na] |
| InChI | InChI=1S/C7HF15O3S.Na/c8-1(9,2(10,11)4(14,15)6(18,19)20)3(12,13)5(16,17)7(21,22)26(23,24)25;/h(H,23,24,25); |
| InChIKey | KVOPKKOJBCAORG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.11 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|