C6H2F13LiO3S — CID 173020254
lithium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonic acid (PubChem CID 173020254) has the molecular formula C6H2F13LiO3S and a molecular weight of 408.06 g/mol. Its IUPAC name is lithium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonic acid.
| Compound Name | lithium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 173020254 |
| Molecular Formula | C6H2F13LiO3S |
| Molecular Weight | 408.06 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | lithium;hydride;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C6HF13O3S.Li.H/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22;;/h(H,20,21,22);;/q;+1;-1 |
| InChIKey | VDFKXXTVDQNFAM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.06 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|