C4H4F9O3SSb — CID 173196652
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;stibane (PubChem CID 173196652) has the molecular formula C4H4F9O3SSb and a molecular weight of 424.88 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;stibane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;stibane |
|---|---|
| PubChem CID | 173196652 |
| Molecular Formula | C4H4F9O3SSb |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 423.88 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;stibane |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[SbH3] |
| InChI | InChI=1S/C4HF9O3S.Sb.3H/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;;;;/h(H,14,15,16);;;; |
| InChIKey | VFODTLLCXAOKBK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|