C6H7F9O3S2 — CID 162540843
methylsulfanylmethane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 162540843) has the molecular formula C6H7F9O3S2 and a molecular weight of 362.24 g/mol. Its IUPAC name is methylsulfanylmethane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | methylsulfanylmethane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 162540843 |
| Molecular Formula | C6H7F9O3S2 |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | methylsulfanylmethane;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | CSC.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9O3S.C2H6S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;1-3-2/h(H,14,15,16);1-2H3 |
| InChIKey | RSBHQNZEWDEJFU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|